CAS 1427380-80-0 appears in our catalog under these names: 2-Amino-3,3,3-trifluoro-2-(3-(trifluoromethyl)phenyl)propanoic acid, 95%, 2-Amino-3,3,3-trifluoro-2-(3-(trifluoromethyl)phenyl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-amino-3,3,3-trifluoro-2-[3-(trifluoromethyl)phenyl]propanoic acid (CAS 1427380-80-0) is a chemical compound with the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. IUPAC name: 2-amino-3,3,3-trifluoro-2-[3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: NWAFPWFGGFFLDE-UHFFFAOYSA-N.
| Molecular formula | C10H7F6NO2 |
|---|---|
| Molecular weight | 287.16 g/mol |
| IUPAC name | 2-amino-3,3,3-trifluoro-2-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | NWAFPWFGGFFLDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C(=O)O)(C(F)(F)F)N |
Computed by PubChem (NCBI)