CAS 259655-26-0 is the registry number for 2,4-Bis(trifluoromethyl)-6-methoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methoxy-4,6-bis(trifluoromethyl)benzamide (CAS 259655-26-0) is a chemical compound with the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. IUPAC name: 2-methoxy-4,6-bis(trifluoromethyl)benzamide. InChIKey: ALYULHHERVJIOA-UHFFFAOYSA-N.
| Molecular formula | C10H7F6NO2 |
|---|---|
| Molecular weight | 287.16 g/mol |
| IUPAC name | 2-methoxy-4,6-bis(trifluoromethyl)benzamide |
| InChIKey | ALYULHHERVJIOA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)