CAS 23794-80-1 is the registry number for ETG-5773, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,2,2-trifluoroethyl N-[4-(trifluoromethyl)phenyl]carbamate (CAS 23794-80-1) is a chemical compound with the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-[4-(trifluoromethyl)phenyl]carbamate. InChIKey: LQCXCGJWHXQZMV-UHFFFAOYSA-N.
| Molecular formula | C10H7F6NO2 |
|---|---|
| Molecular weight | 287.16 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-[4-(trifluoromethyl)phenyl]carbamate |
| InChIKey | LQCXCGJWHXQZMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)