CAS 1427380-93-5 is the registry number for (3,4-Difluorophenyl)(1,2,4-oxadiazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(3,4-difluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (CAS 1427380-93-5) is a chemical compound with the molecular formula C9H8ClF2N3O and a molecular weight of 247.63 g/mol. IUPAC name: (3,4-difluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine;hydrochloride. InChIKey: DXAFRDVLZKGRAR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2N3O |
|---|---|
| Molecular weight | 247.63 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| InChIKey | DXAFRDVLZKGRAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C2=NOC=N2)N)F)F.Cl |
Computed by PubChem (NCBI)