CAS 1609395-83-6 is the registry number for ([5-(2,6-Difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CAS 1609395-83-6) is a chemical compound with the molecular formula C9H8ClF2N3O and a molecular weight of 247.63 g/mol. IUPAC name: [5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride. InChIKey: ADLAIJXOJZVLNT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2N3O |
|---|---|
| Molecular weight | 247.63 g/mol |
| IUPAC name | [5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| InChIKey | ADLAIJXOJZVLNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NC(=NO2)CN)F.Cl |
Computed by PubChem (NCBI)