CAS 1798731-87-9 appears in our catalog under these names: 4-(5-(Difluoromethyl)-1,2,4-oxadiazol-3-yl)aniline hydrochloride, 95%, 4-(5-(Difluoromethyl)-1,2,4-oxadiazol-3-yl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride (CAS 1798731-87-9) is a chemical compound with the molecular formula C9H8ClF2N3O and a molecular weight of 247.63 g/mol. IUPAC name: 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride. InChIKey: IQSVQMGFDPRCPA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2N3O |
|---|---|
| Molecular weight | 247.63 g/mol |
| IUPAC name | 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride |
| InChIKey | IQSVQMGFDPRCPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)F)N.Cl |
Computed by PubChem (NCBI)