CAS 1427428-42-9 appears in our catalog under these names: 4-Bromo-5-fluoro-1,3-dioxaindane, 4-Bromo-5-fluorobenzo[d][1,3]dioxole 98%, 4-bromo-5-fluoro-1,3-dioxaindane, 98%, 98%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g.
4-bromo-5-fluoro-1,3-benzodioxole (CAS 1427428-42-9) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 4-bromo-5-fluoro-1,3-benzodioxole. InChIKey: OHUWAUIJHDBDIT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 4-bromo-5-fluoro-1,3-benzodioxole |
| InChIKey | OHUWAUIJHDBDIT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)F)Br |
Computed by PubChem (NCBI)