CAS 1427452-60-5 is the registry number for 8-Methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (CAS 1427452-60-5) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid. InChIKey: CDXOIUSXXZVYHC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
| InChIKey | CDXOIUSXXZVYHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC=N2)C(=O)O |
Computed by PubChem (NCBI)