Products 1427501-80-1
CAS 1427501-80-1 is the registry number for 4,6-Dichloropyrazolo[1,5-a]pyridine, 90%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4,6-dichloropyrazolo[1,5-a]pyridine (CAS 1427501-80-1) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4,6-dichloropyrazolo[1,5-a]pyridine. InChIKey: UTXPDPIIVRGLFE-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4,6-dichloropyrazolo[1,5-a]pyridine |
| InChIKey | UTXPDPIIVRGLFE-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=CN2N=C1)Cl)Cl |
Computed by PubChem (NCBI)