Products 1428143-51-4
CAS 1428143-51-4 is the registry number for 4-(5-Trifluoromethyl-2h-pyrazol-3-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate (CAS 1428143-51-4) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: methyl 4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate. InChIKey: MIYIDCQSBCBMON-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | methyl 4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate |
| InChIKey | MIYIDCQSBCBMON-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NNC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)