CAS 142818-02-8 is the registry number for 1-(tert-Butyl)-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 142818-02-8) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: 1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: LBPZUNLSYYEDFB-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | 1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | LBPZUNLSYYEDFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=C(C=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)