CAS 2173100-49-5 is the registry number for tert-Butyl 5-(trifluoromethyl)pyrazole-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
Tert-butyl 5-(trifluoromethyl)pyrazole-1-carboxylate (CAS 2173100-49-5) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: tert-butyl 5-(trifluoromethyl)pyrazole-1-carboxylate. InChIKey: NIVMEEXNKLKLFE-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | tert-butyl 5-(trifluoromethyl)pyrazole-1-carboxylate |
| InChIKey | NIVMEEXNKLKLFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=CC=N1)C(F)(F)F |
Computed by PubChem (NCBI)