CAS 2243513-99-5 is the registry number for [2-(trifluoromethyl)pyridin-3-yl]methanamine acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
Acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine (CAS 2243513-99-5) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine. InChIKey: BLGPRSKPIZDSRL-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine |
| InChIKey | BLGPRSKPIZDSRL-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CC(=C(N=C1)C(F)(F)F)CN |
Computed by PubChem (NCBI)