Products 2243513-99-5

CAS 2243513-99-5 is the registry number for [2-(trifluoromethyl)pyridin-3-yl]methanamine acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

Acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine (CAS 2243513-99-5) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine. InChIKey: BLGPRSKPIZDSRL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11F3N2O2
Molecular weight236.19 g/mol
IUPAC nameacetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine
InChIKeyBLGPRSKPIZDSRL-UHFFFAOYSA-N
SMILESCC(=O)O.C1=CC(=C(N=C1)C(F)(F)F)CN

Computed by PubChem (NCBI)