Products 1824601-80-0
CAS 1824601-80-0 is the registry number for 2-Chloro-1-(methylthio)-3-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1-methylsulfanyl-3-(trifluoromethyl)benzene (CAS 1824601-80-0) is a chemical compound with the molecular formula C8H6ClF3S and a molecular weight of 226.65 g/mol. IUPAC name: 2-chloro-1-methylsulfanyl-3-(trifluoromethyl)benzene. InChIKey: RDDATZHAQJARPY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3S |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 2-chloro-1-methylsulfanyl-3-(trifluoromethyl)benzene |
| InChIKey | RDDATZHAQJARPY-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC(=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)