Products 1428257-54-8
CAS 1428257-54-8 is the registry number for 3,5,6-Tribromo-1,2-dihydroacenaphthylene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
3,5,6-tribromo-1,2-dihydroacenaphthylene (CAS 1428257-54-8) is a chemical compound with the molecular formula C12H7Br3 and a molecular weight of 390.90 g/mol. IUPAC name: 3,5,6-tribromo-1,2-dihydroacenaphthylene. InChIKey: WFHZQSBRIFNEGB-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3 |
|---|---|
| Molecular weight | 390.90 g/mol |
| IUPAC name | 3,5,6-tribromo-1,2-dihydroacenaphthylene |
| InChIKey | WFHZQSBRIFNEGB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C3=C(C=CC1=C23)Br)Br)Br |
Computed by PubChem (NCBI)