CAS 213176-15-9 is the registry number for (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-6-hydroxyhexanoate. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
1,2-dibromo-4-(4-bromophenyl)benzene (CAS 213176-15-9) is a chemical compound with the molecular formula C12H7Br3 and a molecular weight of 390.90 g/mol. IUPAC name: 1,2-dibromo-4-(4-bromophenyl)benzene. InChIKey: BYQYWRHKDIPDTI-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3 |
|---|---|
| Molecular weight | 390.90 g/mol |
| IUPAC name | 1,2-dibromo-4-(4-bromophenyl)benzene |
| InChIKey | BYQYWRHKDIPDTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)Br)Br)Br |
Computed by PubChem (NCBI)