CAS 72416-87-6 is the registry number for 3,4',5-Tribromobiphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,3-dibromo-5-(4-bromophenyl)benzene (CAS 72416-87-6) is a chemical compound with the molecular formula C12H7Br3 and a molecular weight of 390.90 g/mol. IUPAC name: 1,3-dibromo-5-(4-bromophenyl)benzene. InChIKey: PMLLBFUHDNYTAP-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3 |
|---|---|
| Molecular weight | 390.90 g/mol |
| IUPAC name | 1,3-dibromo-5-(4-bromophenyl)benzene |
| InChIKey | PMLLBFUHDNYTAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Br)Br)Br |
Computed by PubChem (NCBI)