CAS 1428730-05-5 is the registry number for Neurosensor 521. Offered by: TRC. Available pack sizes: 100mg.
7-(diethylamino)-4-(4-methoxyphenyl)-2-oxochromene-3-carbaldehyde (CAS 1428730-05-5) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 7-(diethylamino)-4-(4-methoxyphenyl)-2-oxochromene-3-carbaldehyde. InChIKey: GOYKALWTTJFRLM-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 7-(diethylamino)-4-(4-methoxyphenyl)-2-oxochromene-3-carbaldehyde |
| InChIKey | GOYKALWTTJFRLM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C(C(=O)O2)C=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)