Products 1428974-63-3
CAS 1428974-63-3 is the registry number for (1,2,3,4-Tetrahydroquinolin-6-ylsulfanyl)formonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1,2,3,4-tetrahydroquinolin-6-yl thiocyanate (CAS 1428974-63-3) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinolin-6-yl thiocyanate. InChIKey: WBNSNIRGCHXGBI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinolin-6-yl thiocyanate |
| InChIKey | WBNSNIRGCHXGBI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)SC#N)NC1 |
Computed by PubChem (NCBI)