CAS 1429055-05-9 is the registry number for Ixazomib Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-N-[2-(3-methylbutylideneamino)-2-oxoethyl]benzamide (CAS 1429055-05-9) is a chemical compound with the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.2 g/mol. IUPAC name: 2,5-dichloro-N-[2-(3-methylbutylideneamino)-2-oxoethyl]benzamide. InChIKey: UGWWMIXMFGGUDR-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2O2 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2,5-dichloro-N-[2-(3-methylbutylideneamino)-2-oxoethyl]benzamide |
| InChIKey | UGWWMIXMFGGUDR-UHFFFAOYSA-N |
| SMILES | CC(C)CC=NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)