CAS 2629270-03-5 is the registry number for PP48. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-1-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]ethanone (CAS 2629270-03-5) is a chemical compound with the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.2 g/mol. IUPAC name: 2-chloro-1-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]ethanone. InChIKey: DMIKXMIJCLWNFR-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2O2 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2-chloro-1-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]ethanone |
| InChIKey | DMIKXMIJCLWNFR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C1)C(=O)C2=CC=C(C=C2)Cl)C(=O)CCl |
Computed by PubChem (NCBI)