Products 2305253-49-8

CAS 2305253-49-8 is the registry number for Methyl 2-amino-2-(3-(pyridin-4-yl)phenyl)acetate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-(3-pyridin-4-ylphenyl)acetate;dihydrochloride (CAS 2305253-49-8) is a chemical compound with the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.2 g/mol. IUPAC name: methyl 2-amino-2-(3-pyridin-4-ylphenyl)acetate;dihydrochloride. InChIKey: HMGQRRVRVXZGDA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16Cl2N2O2
Molecular weight315.2 g/mol
IUPAC namemethyl 2-amino-2-(3-pyridin-4-ylphenyl)acetate;dihydrochloride
InChIKeyHMGQRRVRVXZGDA-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC=CC(=C1)C2=CC=NC=C2)N.Cl.Cl

Computed by PubChem (NCBI)