Products 1429247-57-3
CAS 1429247-57-3 appears in our catalog under these names: 7-Fluoro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 7-Fluoro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
7-fluoro-2,2-dimethyl-3H-inden-1-one (CAS 1429247-57-3) is a chemical compound with the molecular formula C11H11FO and a molecular weight of 178.20 g/mol. IUPAC name: 7-fluoro-2,2-dimethyl-3H-inden-1-one. InChIKey: JHBDYDWXNUSGCU-UHFFFAOYSA-N.
| Molecular formula | C11H11FO |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 7-fluoro-2,2-dimethyl-3H-inden-1-one |
| InChIKey | JHBDYDWXNUSGCU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1=O)C(=CC=C2)F)C |
Computed by PubChem (NCBI)