Products 1429321-83-4
CAS 1429321-83-4 is the registry number for 2-Fluoro-3-(trifluoromethoxy)phenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-[2-fluoro-3-(trifluoromethoxy)phenyl]ethanone (CAS 1429321-83-4) is a chemical compound with the molecular formula C9H5BrF4O2 and a molecular weight of 301.03 g/mol. IUPAC name: 2-bromo-1-[2-fluoro-3-(trifluoromethoxy)phenyl]ethanone. InChIKey: ZPCAZEUWQWAEGU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF4O2 |
|---|---|
| Molecular weight | 301.03 g/mol |
| IUPAC name | 2-bromo-1-[2-fluoro-3-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | ZPCAZEUWQWAEGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)F)C(=O)CBr |
Computed by PubChem (NCBI)