Products 1823569-26-1
CAS 1823569-26-1 appears in our catalog under these names: 6-(Bromomethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxane, 95%, 6-(Bromomethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-(bromomethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxine (CAS 1823569-26-1) is a chemical compound with the molecular formula C9H5BrF4O2 and a molecular weight of 301.03 g/mol. IUPAC name: 6-(bromomethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxine. InChIKey: WANHPMCZAXHPTH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF4O2 |
|---|---|
| Molecular weight | 301.03 g/mol |
| IUPAC name | 6-(bromomethyl)-2,2,3,3-tetrafluoro-1,4-benzodioxine |
| InChIKey | WANHPMCZAXHPTH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CBr)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)