Products 1448246-57-8
CAS 1448246-57-8 is the registry number for 3-Fluoro-4-(trifluoromethoxy)phenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-bromo-1-[3-fluoro-4-(trifluoromethoxy)phenyl]ethanone (CAS 1448246-57-8) is a chemical compound with the molecular formula C9H5BrF4O2 and a molecular weight of 301.03 g/mol. IUPAC name: 2-bromo-1-[3-fluoro-4-(trifluoromethoxy)phenyl]ethanone. InChIKey: FMZFAEYQJAWXNW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF4O2 |
|---|---|
| Molecular weight | 301.03 g/mol |
| IUPAC name | 2-bromo-1-[3-fluoro-4-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | FMZFAEYQJAWXNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)F)OC(F)(F)F |
Computed by PubChem (NCBI)