Products 913086-29-0
CAS 913086-29-0 is the registry number for Fmoc-β-Me-Glu(OtBu)-OH 98%. Offered by: Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 913086-29-0) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: HYWKADVVVLDYEH-NYHFZMIOSA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | HYWKADVVVLDYEH-NYHFZMIOSA-N |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)