CAS 1429903-79-6 is the registry number for 2-(2,5-Dimethoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,5-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxylic acid (CAS 1429903-79-6) is a chemical compound with the molecular formula C18H15NO5 and a molecular weight of 325.3 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxylic acid. InChIKey: PMDFQOPDMNBTHJ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO5 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)-1-oxoisoquinoline-4-carboxylic acid |
| InChIKey | PMDFQOPDMNBTHJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)N2C=C(C3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)