Products 287971-19-1

CAS 287971-19-1 is the registry number for 2-(Phenylmethoxy)benzoic acid 2,5-dioxo-1-pyrrolidinyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2-phenylmethoxybenzoate (CAS 287971-19-1) is a chemical compound with the molecular formula C18H15NO5 and a molecular weight of 325.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-phenylmethoxybenzoate. InChIKey: KMMXKENUWNXWHS-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO5
Molecular weight325.3 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2-phenylmethoxybenzoate
InChIKeyKMMXKENUWNXWHS-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)C2=CC=CC=C2OCC3=CC=CC=C3

Computed by PubChem (NCBI)