CAS 25613-60-9 is the registry number for Z-L-Phenylalanine N-carboxyanhydride. Offered by: Creative Peptides. Available pack sizes: on request.
Benzyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS 25613-60-9) is a chemical compound with the molecular formula C18H15NO5 and a molecular weight of 325.3 g/mol. IUPAC name: benzyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate. InChIKey: XGEVCUXPCGZQLQ-HNNXBMFYSA-N.
| Molecular formula | C18H15NO5 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | benzyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| InChIKey | XGEVCUXPCGZQLQ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H]2C(=O)OC(=O)N2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)