CAS 142995-28-6 appears in our catalog under these names: (S)-2-Amino-3-(3,4-dimethylphenyl)propanoic acid, 95%, (S)-2-Amino-3-(3,4-dimethylphenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2S)-2-amino-3-(3,4-dimethylphenyl)propanoic acid (CAS 142995-28-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dimethylphenyl)propanoic acid. InChIKey: PHTDECHKNDJYMG-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dimethylphenyl)propanoic acid |
| InChIKey | PHTDECHKNDJYMG-JTQLQIEISA-N |
| SMILES | CC1=C(C=C(C=C1)C[C@@H](C(=O)O)N)C |
Computed by PubChem (NCBI)