Products 14310-22-6
CAS 14310-22-6 is the registry number for 1-Chloro-4-(2-phenylethyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-chloro-4-(2-phenylethyl)benzene (CAS 14310-22-6) is a chemical compound with the molecular formula C14H13Cl and a molecular weight of 216.70 g/mol. IUPAC name: 1-chloro-4-(2-phenylethyl)benzene. InChIKey: WZTJFRVXSHGGEF-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl |
|---|---|
| Molecular weight | 216.70 g/mol |
| IUPAC name | 1-chloro-4-(2-phenylethyl)benzene |
| InChIKey | WZTJFRVXSHGGEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)