Products 92189-88-3
CAS 92189-88-3 is the registry number for 2-Chloro-1-methyl-4-(4-methylphenyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-1-methyl-4-(4-methylphenyl)benzene (CAS 92189-88-3) is a chemical compound with the molecular formula C14H13Cl and a molecular weight of 216.70 g/mol. IUPAC name: 2-chloro-1-methyl-4-(4-methylphenyl)benzene. InChIKey: SJDZUSHAMYHPNB-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl |
|---|---|
| Molecular weight | 216.70 g/mol |
| IUPAC name | 2-chloro-1-methyl-4-(4-methylphenyl)benzene |
| InChIKey | SJDZUSHAMYHPNB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)C)Cl |
Computed by PubChem (NCBI)