CAS 724423-52-3 is the registry number for 4′-Chloro-2,6-dimethyl-1,1′-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(4-chlorophenyl)-1,3-dimethylbenzene (CAS 724423-52-3) is a chemical compound with the molecular formula C14H13Cl and a molecular weight of 216.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-dimethylbenzene. InChIKey: HMSKQKDJYMYTKP-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl |
|---|---|
| Molecular weight | 216.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-dimethylbenzene |
| InChIKey | HMSKQKDJYMYTKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)