CAS 75464-11-8 appears in our catalog under these names: Dithranol Impurity 10, Butantrone. Offered by: Hubei YoungXin, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, Get quote.
10-butanoyl-1,8-dihydroxy-10H-anthracen-9-one (CAS 75464-11-8) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 10-butanoyl-1,8-dihydroxy-10H-anthracen-9-one. InChIKey: AHZXFRRDQXXPJD-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 10-butanoyl-1,8-dihydroxy-10H-anthracen-9-one |
| InChIKey | AHZXFRRDQXXPJD-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC=C3O |
Computed by PubChem (NCBI)