CAS 1431377-53-5 appears in our catalog under these names: 3,6-Dihydroxy-10,10-dimethylanthrone, 95%, 3,6-Dihydroxy-10,10-dimethylanthracen-9(10H)-one 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
3,6-dihydroxy-10,10-dimethylanthracen-9-one (CAS 1431377-53-5) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 3,6-dihydroxy-10,10-dimethylanthracen-9-one. InChIKey: WXDRXTWBNLQLJD-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 3,6-dihydroxy-10,10-dimethylanthracen-9-one |
| InChIKey | WXDRXTWBNLQLJD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)O)C(=O)C3=C1C=C(C=C3)O)C |
Computed by PubChem (NCBI)