CAS 14315-26-5 is the registry number for 3-Amino-n-(4-methylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-N-(4-methylphenyl)benzamide (CAS 14315-26-5) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 3-amino-N-(4-methylphenyl)benzamide. InChIKey: SFMBQQUKFGHDDU-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-amino-N-(4-methylphenyl)benzamide |
| InChIKey | SFMBQQUKFGHDDU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)