CAS 1431654-74-8 appears in our catalog under these names: 6-(2,2,2-Trifluoroethoxy)pyrazin-2-amine, 98+%, 6-(2,2,2-Trifluoroethoxy)pyrazin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
6-(2,2,2-trifluoroethoxy)pyrazin-2-amine (CAS 1431654-74-8) is a chemical compound with the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyrazin-2-amine. InChIKey: UDXNBGXOAPVQTH-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3O |
|---|---|
| Molecular weight | 193.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyrazin-2-amine |
| InChIKey | UDXNBGXOAPVQTH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C=N1)OCC(F)(F)F)N |
Computed by PubChem (NCBI)