CAS 1431720-68-1 appears in our catalog under these names: 6-Chloro-3-(trifluoromethyl)-1h-pyrazolo[4,3-c]pyridine, 95%, 6–Chloro–3–(trifluoromethyl)–1H–pyrazolo(4,3–c)pyridine, 6-CHLORO-3-(TRIFLUOROMETHYL)-1H-PYRAZOLO[4,3-C]PYRIDINE, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g.
6-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine (CAS 1431720-68-1) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 6-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine. InChIKey: FICNSZCHYFKLLD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 6-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | FICNSZCHYFKLLD-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=C(NN=C21)C(F)(F)F)Cl |
Computed by PubChem (NCBI)