CAS 1443283-97-3 is the registry number for 6-Chloro-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridine (CAS 1443283-97-3) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridine. InChIKey: ADUBVKTWFSPYRL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridine |
| InChIKey | ADUBVKTWFSPYRL-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NN=C2)N=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)