CAS 1934633-19-8 is the registry number for 2-Chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 1934633-19-8) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: JYGFBZMVYKCERR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | JYGFBZMVYKCERR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)