Products 1431721-01-5
CAS 1431721-01-5 appears in our catalog under these names: 3,6-Dichloro-1H-pyrazolo[4,3-c]pyridine, 95%, 95%, 3,6-Dichloro-1H-pyrazolo[4,3-c]pyridine, 95%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
3,6-dichloro-2H-pyrazolo[4,3-c]pyridine (CAS 1431721-01-5) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3,6-dichloro-2H-pyrazolo[4,3-c]pyridine. InChIKey: PHRKUMZOBIWJBZ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,6-dichloro-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | PHRKUMZOBIWJBZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=C(NN=C21)Cl)Cl |
Computed by PubChem (NCBI)