CAS 1431842-80-6 appears in our catalog under these names: 2–(3,5–dichloropyridin–2–yl)–2,2–difluoroethan–1–ol, 2-(3,5-dichloropyridin-2-yl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 200mg, 5g.
2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroethanol (CAS 1431842-80-6) is a chemical compound with the molecular formula C7H5Cl2F2NO and a molecular weight of 228.02 g/mol. IUPAC name: 2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroethanol. InChIKey: YEOZBOOBDFVCKC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F2NO |
|---|---|
| Molecular weight | 228.02 g/mol |
| IUPAC name | 2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroethanol |
| InChIKey | YEOZBOOBDFVCKC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(CO)(F)F)Cl |
Computed by PubChem (NCBI)