CAS 2228800-04-0 is the registry number for 2-(2,6-Dichloropyridin-4-yl)-2,2-difluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroethanol (CAS 2228800-04-0) is a chemical compound with the molecular formula C7H5Cl2F2NO and a molecular weight of 228.02 g/mol. IUPAC name: 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroethanol. InChIKey: YBACOWDXXURSNZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F2NO |
|---|---|
| Molecular weight | 228.02 g/mol |
| IUPAC name | 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroethanol |
| InChIKey | YBACOWDXXURSNZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(CO)(F)F |
Computed by PubChem (NCBI)