CAS 1804421-14-4 is the registry number for 2,5-Dichloro-4-(difluoromethoxy)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5-dichloro-4-(difluoromethoxy)aniline (CAS 1804421-14-4) is a chemical compound with the molecular formula C7H5Cl2F2NO and a molecular weight of 228.02 g/mol. IUPAC name: 2,5-dichloro-4-(difluoromethoxy)aniline. InChIKey: SLVLLTDZVJXRAD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F2NO |
|---|---|
| Molecular weight | 228.02 g/mol |
| IUPAC name | 2,5-dichloro-4-(difluoromethoxy)aniline |
| InChIKey | SLVLLTDZVJXRAD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)OC(F)F)Cl)N |
Computed by PubChem (NCBI)