Products 1431963-50-6

CAS 1431963-50-6 is the registry number for Methyl 3-((cyclohexylamino)methyl)-4-methoxybenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-[(cyclohexylamino)methyl]-4-methoxybenzoate;hydrochloride (CAS 1431963-50-6) is a chemical compound with the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. IUPAC name: methyl 3-[(cyclohexylamino)methyl]-4-methoxybenzoate;hydrochloride. InChIKey: KGXZKOXUQWEUOU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24ClNO3
Molecular weight313.82 g/mol
IUPAC namemethyl 3-[(cyclohexylamino)methyl]-4-methoxybenzoate;hydrochloride
InChIKeyKGXZKOXUQWEUOU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)OC)CNC2CCCCC2.Cl

Computed by PubChem (NCBI)