CAS 1432040-88-4 appears in our catalog under these names: 6-Hydroxybenzo[b]thiophene-2-carboxylic acid, 95%, 6-Hydroxybenzo(b)thiophene-2-carboxylic acid, 97%, 6-HYDROXYBENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-hydroxy-1-benzothiophene-2-carboxylic acid (CAS 1432040-88-4) is a chemical compound with the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. IUPAC name: 6-hydroxy-1-benzothiophene-2-carboxylic acid. InChIKey: KWLDGGAFDRUFPZ-UHFFFAOYSA-N.
| Molecular formula | C9H6O3S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 6-hydroxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | KWLDGGAFDRUFPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)