Products 560993-95-5
CAS 560993-95-5 appears in our catalog under these names: 5-(Thiophen-3-yl)furan-2-carboxylic acid, 95+%, 95+%, 5-(Thiophen-3-yl)furan-2-carboxylic acid, 95%, 5-Thiophen-3-yl-furan-2-carboxylic acid, 95+%, 5-(Thiophen-3-yl)furan-2-carboxylic acid, 95+%. Offered by: Chemat, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-thiophen-3-ylfuran-2-carboxylic acid (CAS 560993-95-5) is a chemical compound with the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. IUPAC name: 5-thiophen-3-ylfuran-2-carboxylic acid. InChIKey: JBPGCCPYLDMCHQ-UHFFFAOYSA-N.
| Molecular formula | C9H6O3S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 5-thiophen-3-ylfuran-2-carboxylic acid |
| InChIKey | JBPGCCPYLDMCHQ-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)