Products 16304-39-5

CAS 16304-39-5 is the registry number for 5-Hydroxybenzo[b]thiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-hydroxy-1-benzothiophene-3-carboxylic acid (CAS 16304-39-5) is a chemical compound with the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. IUPAC name: 5-hydroxy-1-benzothiophene-3-carboxylic acid. InChIKey: ZAZIPEFQVRYIGU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6O3S
Molecular weight194.21 g/mol
IUPAC name5-hydroxy-1-benzothiophene-3-carboxylic acid
InChIKeyZAZIPEFQVRYIGU-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1O)C(=CS2)C(=O)O

Computed by PubChem (NCBI)