CAS 16304-39-5 is the registry number for 5-Hydroxybenzo[b]thiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-hydroxy-1-benzothiophene-3-carboxylic acid (CAS 16304-39-5) is a chemical compound with the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. IUPAC name: 5-hydroxy-1-benzothiophene-3-carboxylic acid. InChIKey: ZAZIPEFQVRYIGU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 5-hydroxy-1-benzothiophene-3-carboxylic acid |
| InChIKey | ZAZIPEFQVRYIGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)