CAS 1432323-27-7 appears in our catalog under these names: 4-Bromo-8-methyl-1,5-naphthyridine, 95%, 4–Bromo–8–methyl–1，5–naphthyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
4-bromo-8-methyl-1,5-naphthyridine (CAS 1432323-27-7) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 4-bromo-8-methyl-1,5-naphthyridine. InChIKey: RCWVZPCMTYJNGG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 4-bromo-8-methyl-1,5-naphthyridine |
| InChIKey | RCWVZPCMTYJNGG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1)C(=CC=N2)Br |
Computed by PubChem (NCBI)